C20H31N3O2 — CID 21362801
N-[(1-methylpiperidin-4-yl)methyl]-7-nitro-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 21362801) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[(1-methylpiperidin-4-yl)methyl]-7-nitro-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | N-[(1-methylpiperidin-4-yl)methyl]-7-nitro-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 21362801 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | N-[(1-methylpiperidin-4-yl)methyl]-7-nitro-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCN(CC1CCN(C)CC1)C1CCc2ccc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C20H31N3O2/c1-3-10-22(15-16-8-11-21(2)12-9-16)19-6-4-17-5-7-20(23(24)25)14-18(17)13-19/h5,7,14,16,19H,3-4,6,8-13,15H2,1-2H3 |
| InChIKey | BEEPZBIPMAOWEA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|