C19H29N3O2 — CID 21362811
N-ethyl-N-[(1-methylpiperidin-4-yl)methyl]-7-nitro-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 21362811) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is N-ethyl-N-[(1-methylpiperidin-4-yl)methyl]-7-nitro-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | N-ethyl-N-[(1-methylpiperidin-4-yl)methyl]-7-nitro-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 21362811 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | N-ethyl-N-[(1-methylpiperidin-4-yl)methyl]-7-nitro-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCN(CC1CCN(C)CC1)C1CCc2ccc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C19H29N3O2/c1-3-21(14-15-8-10-20(2)11-9-15)18-6-4-16-5-7-19(22(23)24)13-17(16)12-18/h5,7,13,15,18H,3-4,6,8-12,14H2,1-2H3 |
| InChIKey | ADIKYVUZZJWDKO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|