About 6-methyl-7-(trihydroxy-λ4-sulfanyl)naphthalene-2-sulfonic acid
6-methyl-7-(trihydroxy-λ4-sulfanyl)naphthalene-2-sulfonic acid (PubChem CID 21363114) has the molecular formula C11H12O6S2
and a molecular weight of 304.35 g/mol. Its IUPAC name is 6-methyl-7-(trihydroxy-λ4-sulfanyl)naphthalene-2-sulfonic acid.
Molecular Properties
| Compound Name | 6-methyl-7-(trihydroxy-λ4-sulfanyl)naphthalene-2-sulfonic acid |
| PubChem CID | 21363114 |
| Molecular Formula | C11H12O6S2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 6-methyl-7-(trihydroxy-λ4-sulfanyl)naphthalene-2-sulfonic acid |
| SMILES | Cc1cc2ccc(S(=O)(=O)O)cc2cc1S(O)(O)O |
| InChI | InChI=1S/C11H12O6S2/c1-7-4-8-2-3-10(18(12,13)14)5-9(8)6-11(7)19(15,16)17/h2-6,15-17H,1H3,(H,12,13,14) |
| InChIKey | AWXKKHWMKWXIGV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-7-(trihydroxy-λ4-sulfanyl)naphthalene-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-7-(trihydroxy-λ4-sulfanyl)naphthalene-2-sulfonic acid?
The IUPAC name of 6-methyl-7-(trihydroxy-λ4-sulfanyl)naphthalene-2-sulfonic acid (CID 21363114) is 6-methyl-7-(trihydroxy-λ4-sulfanyl)naphthalene-2-sulfonic acid.
What is the SMILES notation for 6-methyl-7-(trihydroxy-λ4-sulfanyl)naphthalene-2-sulfonic acid?
The canonical SMILES for 6-methyl-7-(trihydroxy-λ4-sulfanyl)naphthalene-2-sulfonic acid is Cc1cc2ccc(S(=O)(=O)O)cc2cc1S(O)(O)O.
What is the InChIKey of 6-methyl-7-(trihydroxy-λ4-sulfanyl)naphthalene-2-sulfonic acid?
The InChIKey is AWXKKHWMKWXIGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O6S2/c1-7-4-8-2-3-10(18(12,13)14)5-9(8)6-11(7)19(15,16)17/h2-6,15-17H,1H3,(H,12,13,14).
What are the key properties of 6-methyl-7-(trihydroxy-λ4-sulfanyl)naphthalene-2-sulfonic acid?
6-methyl-7-(trihydroxy-λ4-sulfanyl)naphthalene-2-sulfonic acid has a molecular weight of 304.35 g/mol, XLogP of 2.98, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-7-(trihydroxy-λ4-sulfanyl)naphthalene-2-sulfonic acid is sourced from PubChem (CID 21363114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).