C14H26O5Si — CID 21363204
4-(3-triethoxysilylpropyl)cyclopentane-1,3-dione (PubChem CID 21363204) has the molecular formula C14H26O5Si and a molecular weight of 302.44 g/mol. Its IUPAC name is 4-(3-triethoxysilylpropyl)cyclopentane-1,3-dione.
| Compound Name | 4-(3-triethoxysilylpropyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 21363204 |
| Molecular Formula | C14H26O5Si |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 4-(3-triethoxysilylpropyl)cyclopentane-1,3-dione |
| SMILES | CCO[Si](CCCC1CC(=O)CC1=O)(OCC)OCC |
| InChI | InChI=1S/C14H26O5Si/c1-4-17-20(18-5-2,19-6-3)9-7-8-12-10-13(15)11-14(12)16/h12H,4-11H2,1-3H3 |
| InChIKey | SRHNRWOXPKHSCP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|