About 1-(1-methoxyethoxymethyl)-2,4-dimethylcyclohexane
1-(1-methoxyethoxymethyl)-2,4-dimethylcyclohexane (PubChem CID 21363320) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is 1-(1-methoxyethoxymethyl)-2,4-dimethylcyclohexane.
Molecular Properties
| Compound Name | 1-(1-methoxyethoxymethyl)-2,4-dimethylcyclohexane |
| PubChem CID | 21363320 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 1-(1-methoxyethoxymethyl)-2,4-dimethylcyclohexane |
| SMILES | COC(C)OCC1CCC(C)CC1C |
| InChI | InChI=1S/C12H24O2/c1-9-5-6-12(10(2)7-9)8-14-11(3)13-4/h9-12H,5-8H2,1-4H3 |
| InChIKey | PRCOTWRHOVYGPK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-methoxyethoxymethyl)-2,4-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methoxyethoxymethyl)-2,4-dimethylcyclohexane?
The IUPAC name of 1-(1-methoxyethoxymethyl)-2,4-dimethylcyclohexane (CID 21363320) is 1-(1-methoxyethoxymethyl)-2,4-dimethylcyclohexane.
What is the SMILES notation for 1-(1-methoxyethoxymethyl)-2,4-dimethylcyclohexane?
The canonical SMILES for 1-(1-methoxyethoxymethyl)-2,4-dimethylcyclohexane is COC(C)OCC1CCC(C)CC1C.
What is the InChIKey of 1-(1-methoxyethoxymethyl)-2,4-dimethylcyclohexane?
The InChIKey is PRCOTWRHOVYGPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2/c1-9-5-6-12(10(2)7-9)8-14-11(3)13-4/h9-12H,5-8H2,1-4H3.
What are the key properties of 1-(1-methoxyethoxymethyl)-2,4-dimethylcyclohexane?
1-(1-methoxyethoxymethyl)-2,4-dimethylcyclohexane has a molecular weight of 200.32 g/mol, XLogP of 3.07, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methoxyethoxymethyl)-2,4-dimethylcyclohexane is sourced from PubChem (CID 21363320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).