About 3-methyl-5,6-di(propan-2-yl)-1,2,4-triazine
3-methyl-5,6-di(propan-2-yl)-1,2,4-triazine (PubChem CID 21363472) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 3-methyl-5,6-di(propan-2-yl)-1,2,4-triazine.
Molecular Properties
| Compound Name | 3-methyl-5,6-di(propan-2-yl)-1,2,4-triazine |
| PubChem CID | 21363472 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 3-methyl-5,6-di(propan-2-yl)-1,2,4-triazine |
| SMILES | Cc1nnc(C(C)C)c(C(C)C)n1 |
| InChI | InChI=1S/C10H17N3/c1-6(2)9-10(7(3)4)13-12-8(5)11-9/h6-7H,1-5H3 |
| InChIKey | KVHQNQCYBUYYGF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-5,6-di(propan-2-yl)-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5,6-di(propan-2-yl)-1,2,4-triazine?
The IUPAC name of 3-methyl-5,6-di(propan-2-yl)-1,2,4-triazine (CID 21363472) is 3-methyl-5,6-di(propan-2-yl)-1,2,4-triazine.
What is the SMILES notation for 3-methyl-5,6-di(propan-2-yl)-1,2,4-triazine?
The canonical SMILES for 3-methyl-5,6-di(propan-2-yl)-1,2,4-triazine is Cc1nnc(C(C)C)c(C(C)C)n1.
What is the InChIKey of 3-methyl-5,6-di(propan-2-yl)-1,2,4-triazine?
The InChIKey is KVHQNQCYBUYYGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3/c1-6(2)9-10(7(3)4)13-12-8(5)11-9/h6-7H,1-5H3.
What are the key properties of 3-methyl-5,6-di(propan-2-yl)-1,2,4-triazine?
3-methyl-5,6-di(propan-2-yl)-1,2,4-triazine has a molecular weight of 179.27 g/mol, XLogP of 2.43, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5,6-di(propan-2-yl)-1,2,4-triazine is sourced from PubChem (CID 21363472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).