C20H32N2O3 — CID 21363566
1-(3-cyclohexyl-2-oxo-3,9-diazabicyclo[3.3.1]nonan-9-yl)-3,3-dimethylpentane-1,2-dione (PubChem CID 21363566) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is 1-(3-cyclohexyl-2-oxo-3,9-diazabicyclo[3.3.1]nonan-9-yl)-3,3-dimethylpentane-1,2-dione.
| Compound Name | 1-(3-cyclohexyl-2-oxo-3,9-diazabicyclo[3.3.1]nonan-9-yl)-3,3-dimethylpentane-1,2-dione |
|---|---|
| PubChem CID | 21363566 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 1-(3-cyclohexyl-2-oxo-3,9-diazabicyclo[3.3.1]nonan-9-yl)-3,3-dimethylpentane-1,2-dione |
| SMILES | CCC(C)(C)C(=O)C(=O)N1C2CCCC1C(=O)N(C1CCCCC1)C2 |
| InChI | InChI=1S/C20H32N2O3/c1-4-20(2,3)17(23)19(25)22-15-11-8-12-16(22)18(24)21(13-15)14-9-6-5-7-10-14/h14-16H,4-13H2,1-3H3 |
| InChIKey | VRZKMOFCJXVQSG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|