C25H37N3O8 — CID 21363675
[1-[3-[4-(2,2-dimethoxyethyl)-5,8-dioxo-4,7,13-triazatricyclo[7.3.1.02,7]tridecan-13-yl]-2-oxopropanoyl]cyclopentyl]methyl acetate (PubChem CID 21363675) has the molecular formula C25H37N3O8 and a molecular weight of 507.58 g/mol. Its IUPAC name is [1-[3-[4-(2,2-dimethoxyethyl)-5,8-dioxo-4,7,13-triazatricyclo[7.3.1.02,7]tridecan-13-yl]-2-oxopropanoyl]cyclopentyl]methyl acetate.
| Compound Name | [1-[3-[4-(2,2-dimethoxyethyl)-5,8-dioxo-4,7,13-triazatricyclo[7.3.1.02,7]tridecan-13-yl]-2-oxopropanoyl]cyclopentyl]methyl acetate |
|---|---|
| PubChem CID | 21363675 |
| Molecular Formula | C25H37N3O8 |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | [1-[3-[4-(2,2-dimethoxyethyl)-5,8-dioxo-4,7,13-triazatricyclo[7.3.1.02,7]tridecan-13-yl]-2-oxopropanoyl]cyclopentyl]methyl acetate |
| SMILES | COC(CN1CC2C3CCCC(C(=O)N2CC1=O)N3CC(=O)C(=O)C1(COC(C)=O)CCCC1)OC |
| InChI | InChI=1S/C25H37N3O8/c1-16(29)36-15-25(9-4-5-10-25)23(32)20(30)12-27-17-7-6-8-18(27)24(33)28-13-21(31)26(11-19(17)28)14-22(34-2)35-3/h17-19,22H,4-15H2,1-3H3 |
| InChIKey | QEQAYUCKCPEGSQ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 122.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|