C25H24F6N2O4 — CID 21363698
1-(1-methoxycyclopentyl)-2-[12-oxo-6,8-bis(trifluoromethyl)-11,17-diazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7-tetraen-17-yl]ethane-1,2-dione (PubChem CID 21363698) has the molecular formula C25H24F6N2O4 and a molecular weight of 530.47 g/mol. Its IUPAC name is 1-(1-methoxycyclopentyl)-2-[12-oxo-6,8-bis(trifluoromethyl)-11,17-diazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7-tetraen-17-yl]ethane-1,2-dione.
| Compound Name | 1-(1-methoxycyclopentyl)-2-[12-oxo-6,8-bis(trifluoromethyl)-11,17-diazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7-tetraen-17-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 21363698 |
| Molecular Formula | C25H24F6N2O4 |
| Molecular Weight | 530.47 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | 1-(1-methoxycyclopentyl)-2-[12-oxo-6,8-bis(trifluoromethyl)-11,17-diazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7-tetraen-17-yl]ethane-1,2-dione |
| SMILES | COC1(C(=O)C(=O)N2C3CCCC2C2=Cc4cc(C(F)(F)F)cc(C(F)(F)F)c4CN2C3=O)CCCC1 |
| InChI | InChI=1S/C25H24F6N2O4/c1-37-23(7-2-3-8-23)20(34)22(36)33-17-5-4-6-18(33)21(35)32-12-15-13(10-19(17)32)9-14(24(26,27)28)11-16(15)25(29,30)31/h9-11,17-18H,2-8,12H2,1H3 |
| InChIKey | FWWWCLYIGYTKJI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|