C29H31N3O9 — CID 21363707
4-(3,5-dimethoxyphenyl)-13-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-4,7,13-triazatricyclo[7.3.1.02,7]tridec-2-ene-5,8-dione (PubChem CID 21363707) has the molecular formula C29H31N3O9 and a molecular weight of 565.58 g/mol. Its IUPAC name is 4-(3,5-dimethoxyphenyl)-13-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-4,7,13-triazatricyclo[7.3.1.02,7]tridec-2-ene-5,8-dione.
| Compound Name | 4-(3,5-dimethoxyphenyl)-13-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-4,7,13-triazatricyclo[7.3.1.02,7]tridec-2-ene-5,8-dione |
|---|---|
| PubChem CID | 21363707 |
| Molecular Formula | C29H31N3O9 |
| Molecular Weight | 565.58 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | 4-(3,5-dimethoxyphenyl)-13-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-4,7,13-triazatricyclo[7.3.1.02,7]tridec-2-ene-5,8-dione |
| SMILES | COc1cc(OC)cc(N2C=C3C4CCCC(C(=O)N3CC2=O)N4C(=O)C(=O)c2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C29H31N3O9/c1-37-18-11-17(12-19(13-18)38-2)30-14-22-20-7-6-8-21(28(35)31(22)15-25(30)33)32(20)29(36)26(34)16-9-23(39-3)27(41-5)24(10-16)40-4/h9-14,20-21H,6-8,15H2,1-5H3 |
| InChIKey | DUBOXPZAXSLXCM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 124.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.58 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|