C26H28N2O6 — CID 21363714
1-(12-oxo-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3,5,7-trien-17-yl)-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione (PubChem CID 21363714) has the molecular formula C26H28N2O6 and a molecular weight of 464.52 g/mol. Its IUPAC name is 1-(12-oxo-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3,5,7-trien-17-yl)-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione.
| Compound Name | 1-(12-oxo-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3,5,7-trien-17-yl)-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 21363714 |
| Molecular Formula | C26H28N2O6 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 1-(12-oxo-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3,5,7-trien-17-yl)-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione |
| SMILES | COc1cc(C(=O)C(=O)N2C3CCCC2C2c4ccccc4CCN2C3=O)cc(OC)c1OC |
| InChI | InChI=1S/C26H28N2O6/c1-32-20-13-16(14-21(33-2)24(20)34-3)23(29)26(31)28-18-9-6-10-19(28)25(30)27-12-11-15-7-4-5-8-17(15)22(18)27/h4-5,7-8,13-14,18-19,22H,6,9-12H2,1-3H3 |
| InChIKey | NTWYIYULRGRJGU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|