C13H20N2O2 — CID 21363782
1-(3,4-dimethoxyphenyl)-4-methylpiperazine (PubChem CID 21363782) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-4-methylpiperazine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-4-methylpiperazine |
|---|---|
| PubChem CID | 21363782 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-4-methylpiperazine |
| SMILES | COc1ccc(N2CCN(C)CC2)cc1OC |
| InChI | InChI=1S/C13H20N2O2/c1-14-6-8-15(9-7-14)11-4-5-12(16-2)13(10-11)17-3/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | MNISEMOJDZIGCN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|