C23H18N8O — CID 21363898
4-(furan-2-yl)-10-[2-(4-pyridin-3-ylphenyl)ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine (PubChem CID 21363898) has the molecular formula C23H18N8O and a molecular weight of 422.45 g/mol. Its IUPAC name is 4-(furan-2-yl)-10-[2-(4-pyridin-3-ylphenyl)ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine.
| Compound Name | 4-(furan-2-yl)-10-[2-(4-pyridin-3-ylphenyl)ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
|---|---|
| PubChem CID | 21363898 |
| Molecular Formula | C23H18N8O |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 4-(furan-2-yl)-10-[2-(4-pyridin-3-ylphenyl)ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
| SMILES | Nc1nc2c(cnn2CCc2ccc(-c3cccnc3)cc2)c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C23H18N8O/c24-23-28-21-18(22-27-20(29-31(22)23)19-4-2-12-32-19)14-26-30(21)11-9-15-5-7-16(8-6-15)17-3-1-10-25-13-17/h1-8,10,12-14H,9,11H2,(H2,24,28) |
| InChIKey | ZJQSURJYBMOICS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 112.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |