C22H17N9O — CID 21363905
4-(furan-2-yl)-10-[2-(4-pyrazin-2-ylphenyl)ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine (PubChem CID 21363905) has the molecular formula C22H17N9O and a molecular weight of 423.44 g/mol. Its IUPAC name is 4-(furan-2-yl)-10-[2-(4-pyrazin-2-ylphenyl)ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine.
| Compound Name | 4-(furan-2-yl)-10-[2-(4-pyrazin-2-ylphenyl)ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
|---|---|
| PubChem CID | 21363905 |
| Molecular Formula | C22H17N9O |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 4-(furan-2-yl)-10-[2-(4-pyrazin-2-ylphenyl)ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
| SMILES | Nc1nc2c(cnn2CCc2ccc(-c3cnccn3)cc2)c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C22H17N9O/c23-22-28-20-16(21-27-19(29-31(21)22)18-2-1-11-32-18)12-26-30(20)10-7-14-3-5-15(6-4-14)17-13-24-8-9-25-17/h1-6,8-9,11-13H,7,10H2,(H2,23,28) |
| InChIKey | DOGUWNXVVNWFSX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |