C22H21F2N9S — CID 21363911
10-[2-[4-(2,4-difluorophenyl)piperazin-1-yl]ethyl]-4-thiophen-2-yl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine (PubChem CID 21363911) has the molecular formula C22H21F2N9S and a molecular weight of 481.54 g/mol. Its IUPAC name is 10-[2-[4-(2,4-difluorophenyl)piperazin-1-yl]ethyl]-4-thiophen-2-yl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine.
| Compound Name | 10-[2-[4-(2,4-difluorophenyl)piperazin-1-yl]ethyl]-4-thiophen-2-yl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
|---|---|
| PubChem CID | 21363911 |
| Molecular Formula | C22H21F2N9S |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 10-[2-[4-(2,4-difluorophenyl)piperazin-1-yl]ethyl]-4-thiophen-2-yl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
| SMILES | Nc1nc2c(cnn2CCN2CCN(c3ccc(F)cc3F)CC2)c2nc(-c3cccs3)nn12 |
| InChI | InChI=1S/C22H21F2N9S/c23-14-3-4-17(16(24)12-14)31-8-5-30(6-9-31)7-10-32-20-15(13-26-32)21-27-19(18-2-1-11-34-18)29-33(21)22(25)28-20/h1-4,11-13H,5-10H2,(H2,25,28) |
| InChIKey | RNEDIZMTUPQJJG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 93.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |