C21H40O5Si — CID 21363981
(3S)-3-[(E)-2-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]heptanoic acid (PubChem CID 21363981) has the molecular formula C21H40O5Si and a molecular weight of 400.63 g/mol. Its IUPAC name is (3S)-3-[(E)-2-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]heptanoic acid.
| Compound Name | (3S)-3-[(E)-2-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]heptanoic acid |
|---|---|
| PubChem CID | 21363981 |
| Molecular Formula | C21H40O5Si |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | (3S)-3-[(E)-2-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]heptanoic acid |
| SMILES | CCCC[C@H](/C=C/[C@@H]1OC(C)(C)O[C@@H]1CO[Si](C)(C)C(C)(C)C)CC(=O)O |
| InChI | InChI=1S/C21H40O5Si/c1-9-10-11-16(14-19(22)23)12-13-17-18(26-21(5,6)25-17)15-24-27(7,8)20(2,3)4/h12-13,16-18H,9-11,14-15H2,1-8H3,(H,22,23)/b13-12+/t16-,17+,18-/m1/s1 |
| InChIKey | WTVIZBCHTLYNFY-KXZRJNSZSA-N |
| XLogP | 5.37 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|