C20H41N4+3 — CID 21364713
1-[5-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)pentyl]-4-propan-2-yl-1,4-diazoniabicyclo[2.2.2]octane (PubChem CID 21364713) has the molecular formula C20H41N4+3 and a molecular weight of 337.58 g/mol. Its IUPAC name is 1-[5-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)pentyl]-4-propan-2-yl-1,4-diazoniabicyclo[2.2.2]octane.
| Compound Name | 1-[5-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)pentyl]-4-propan-2-yl-1,4-diazoniabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 21364713 |
| Molecular Formula | C20H41N4+3 |
| Molecular Weight | 337.58 g/mol |
| Exact Mass | 337.33 |
| IUPAC Name | 1-[5-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)pentyl]-4-propan-2-yl-1,4-diazoniabicyclo[2.2.2]octane |
| SMILES | CC(C)[N+]12CC[N+](CCCCC[N+]34CCN(CC3)CC4)(CC1)CC2 |
| InChI | InChI=1S/C20H41N4/c1-20(2)24-17-14-23(15-18-24,16-19-24)10-5-3-4-9-22-11-6-21(7-12-22)8-13-22/h20H,3-19H2,1-2H3/q+3 |
| InChIKey | LDKLWJVJTLWRCJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.58 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|