About 2-methyl-1,3-di(propan-2-yl)guanidine
2-methyl-1,3-di(propan-2-yl)guanidine (PubChem CID 21364757) has the molecular formula C8H19N3
and a molecular weight of 157.26 g/mol. Its IUPAC name is 2-methyl-1,3-di(propan-2-yl)guanidine.
Molecular Properties
| Compound Name | 2-methyl-1,3-di(propan-2-yl)guanidine |
| PubChem CID | 21364757 |
| Molecular Formula | C8H19N3 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.16 |
| IUPAC Name | 2-methyl-1,3-di(propan-2-yl)guanidine |
| SMILES | CN=C(NC(C)C)NC(C)C |
| InChI | InChI=1S/C8H19N3/c1-6(2)10-8(9-5)11-7(3)4/h6-7H,1-5H3,(H2,9,10,11) |
| InChIKey | FGOBDMIFEHUAEK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1,3-di(propan-2-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,3-di(propan-2-yl)guanidine?
The IUPAC name of 2-methyl-1,3-di(propan-2-yl)guanidine (CID 21364757) is 2-methyl-1,3-di(propan-2-yl)guanidine.
What is the SMILES notation for 2-methyl-1,3-di(propan-2-yl)guanidine?
The canonical SMILES for 2-methyl-1,3-di(propan-2-yl)guanidine is CN=C(NC(C)C)NC(C)C.
What is the InChIKey of 2-methyl-1,3-di(propan-2-yl)guanidine?
The InChIKey is FGOBDMIFEHUAEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N3/c1-6(2)10-8(9-5)11-7(3)4/h6-7H,1-5H3,(H2,9,10,11).
What are the key properties of 2-methyl-1,3-di(propan-2-yl)guanidine?
2-methyl-1,3-di(propan-2-yl)guanidine has a molecular weight of 157.26 g/mol, XLogP of 0.97, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,3-di(propan-2-yl)guanidine is sourced from PubChem (CID 21364757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).