C18H32N2O2 — CID 21364815
3-methyl-4-(2-methylpropyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidine-2,5-dione (PubChem CID 21364815) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 3-methyl-4-(2-methylpropyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-methyl-4-(2-methylpropyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 21364815 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 3-methyl-4-(2-methylpropyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidine-2,5-dione |
| SMILES | CC(C)CC1C(=O)N(C2CC(C)(C)NC(C)(C)C2)C(=O)C1C |
| InChI | InChI=1S/C18H32N2O2/c1-11(2)8-14-12(3)15(21)20(16(14)22)13-9-17(4,5)19-18(6,7)10-13/h11-14,19H,8-10H2,1-7H3 |
| InChIKey | SXTIHUJPPOYQRZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|