About 5-(hydroxymethyl)-1,3,5-triazinan-2-one
5-(hydroxymethyl)-1,3,5-triazinan-2-one (PubChem CID 21365261) has the molecular formula C4H9N3O2
and a molecular weight of 131.13 g/mol. Its IUPAC name is 5-(hydroxymethyl)-1,3,5-triazinan-2-one.
Molecular Properties
| Compound Name | 5-(hydroxymethyl)-1,3,5-triazinan-2-one |
| PubChem CID | 21365261 |
| Molecular Formula | C4H9N3O2 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | 5-(hydroxymethyl)-1,3,5-triazinan-2-one |
| SMILES | O=C1NCN(CO)CN1 |
| InChI | InChI=1S/C4H9N3O2/c8-3-7-1-5-4(9)6-2-7/h8H,1-3H2,(H2,5,6,9) |
| InChIKey | QQDCBDYMPMUNHP-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(hydroxymethyl)-1,3,5-triazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(hydroxymethyl)-1,3,5-triazinan-2-one?
The IUPAC name of 5-(hydroxymethyl)-1,3,5-triazinan-2-one (CID 21365261) is 5-(hydroxymethyl)-1,3,5-triazinan-2-one.
What is the SMILES notation for 5-(hydroxymethyl)-1,3,5-triazinan-2-one?
The canonical SMILES for 5-(hydroxymethyl)-1,3,5-triazinan-2-one is O=C1NCN(CO)CN1.
What is the InChIKey of 5-(hydroxymethyl)-1,3,5-triazinan-2-one?
The InChIKey is QQDCBDYMPMUNHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3O2/c8-3-7-1-5-4(9)6-2-7/h8H,1-3H2,(H2,5,6,9).
What are the key properties of 5-(hydroxymethyl)-1,3,5-triazinan-2-one?
5-(hydroxymethyl)-1,3,5-triazinan-2-one has a molecular weight of 131.13 g/mol, XLogP of -1.53, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(hydroxymethyl)-1,3,5-triazinan-2-one is sourced from PubChem (CID 21365261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).