C25H44O — CID 21365322
1-[1-pentyl-4-(4-pentylcyclohexyl)cyclohexyl]prop-2-yn-1-ol (PubChem CID 21365322) has the molecular formula C25H44O and a molecular weight of 360.63 g/mol. Its IUPAC name is 1-[1-pentyl-4-(4-pentylcyclohexyl)cyclohexyl]prop-2-yn-1-ol.
| Compound Name | 1-[1-pentyl-4-(4-pentylcyclohexyl)cyclohexyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 21365322 |
| Molecular Formula | C25H44O |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 360.34 |
| IUPAC Name | 1-[1-pentyl-4-(4-pentylcyclohexyl)cyclohexyl]prop-2-yn-1-ol |
| SMILES | C#CC(O)C1(CCCCC)CCC(C2CCC(CCCCC)CC2)CC1 |
| InChI | InChI=1S/C25H44O/c1-4-7-9-11-21-12-14-22(15-13-21)23-16-19-25(20-17-23,24(26)6-3)18-10-8-5-2/h3,21-24,26H,4-5,7-20H2,1-2H3 |
| InChIKey | WUWWOOITHSCKHI-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|