About dimethyl-propyl-[4,4,4-trifluoro-3-(trifluoromethyl)-3-trimethylsilyloxybutoxy]silane
dimethyl-propyl-[4,4,4-trifluoro-3-(trifluoromethyl)-3-trimethylsilyloxybutoxy]silane (PubChem CID 21365447) has the molecular formula C13H26F6O2Si2
and a molecular weight of 384.51 g/mol. Its IUPAC name is dimethyl-propyl-[4,4,4-trifluoro-3-(trifluoromethyl)-3-trimethylsilyloxybutoxy]silane.
Molecular Properties
| Compound Name | dimethyl-propyl-[4,4,4-trifluoro-3-(trifluoromethyl)-3-trimethylsilyloxybutoxy]silane |
| PubChem CID | 21365447 |
| Molecular Formula | C13H26F6O2Si2 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | dimethyl-propyl-[4,4,4-trifluoro-3-(trifluoromethyl)-3-trimethylsilyloxybutoxy]silane |
| SMILES | CCC[Si](C)(C)OCCC(O[Si](C)(C)C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H26F6O2Si2/c1-7-10-23(5,6)20-9-8-11(12(14,15)16,13(17,18)19)21-22(2,3)4/h7-10H2,1-6H3 |
| InChIKey | AUBXORXNFOXJHM-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-propyl-[4,4,4-trifluoro-3-(trifluoromethyl)-3-trimethylsilyloxybutoxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-propyl-[4,4,4-trifluoro-3-(trifluoromethyl)-3-trimethylsilyloxybutoxy]silane?
The IUPAC name of dimethyl-propyl-[4,4,4-trifluoro-3-(trifluoromethyl)-3-trimethylsilyloxybutoxy]silane (CID 21365447) is dimethyl-propyl-[4,4,4-trifluoro-3-(trifluoromethyl)-3-trimethylsilyloxybutoxy]silane.
What is the SMILES notation for dimethyl-propyl-[4,4,4-trifluoro-3-(trifluoromethyl)-3-trimethylsilyloxybutoxy]silane?
The canonical SMILES for dimethyl-propyl-[4,4,4-trifluoro-3-(trifluoromethyl)-3-trimethylsilyloxybutoxy]silane is CCC[Si](C)(C)OCCC(O[Si](C)(C)C)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of dimethyl-propyl-[4,4,4-trifluoro-3-(trifluoromethyl)-3-trimethylsilyloxybutoxy]silane?
The InChIKey is AUBXORXNFOXJHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26F6O2Si2/c1-7-10-23(5,6)20-9-8-11(12(14,15)16,13(17,18)19)21-22(2,3)4/h7-10H2,1-6H3.
What are the key properties of dimethyl-propyl-[4,4,4-trifluoro-3-(trifluoromethyl)-3-trimethylsilyloxybutoxy]silane?
dimethyl-propyl-[4,4,4-trifluoro-3-(trifluoromethyl)-3-trimethylsilyloxybutoxy]silane has a molecular weight of 384.51 g/mol, XLogP of 5.72, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-propyl-[4,4,4-trifluoro-3-(trifluoromethyl)-3-trimethylsilyloxybutoxy]silane is sourced from PubChem (CID 21365447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).