About trimethyl-[1,1,1-trifluoro-4-[methoxy(dimethyl)silyl]-2-(trifluoromethyl)butan-2-yl]oxysilane
trimethyl-[1,1,1-trifluoro-4-[methoxy(dimethyl)silyl]-2-(trifluoromethyl)butan-2-yl]oxysilane (PubChem CID 21365449) has the molecular formula C11H22F6O2Si2
and a molecular weight of 356.46 g/mol. Its IUPAC name is trimethyl-[1,1,1-trifluoro-4-[methoxy(dimethyl)silyl]-2-(trifluoromethyl)butan-2-yl]oxysilane.
Molecular Properties
| Compound Name | trimethyl-[1,1,1-trifluoro-4-[methoxy(dimethyl)silyl]-2-(trifluoromethyl)butan-2-yl]oxysilane |
| PubChem CID | 21365449 |
| Molecular Formula | C11H22F6O2Si2 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | trimethyl-[1,1,1-trifluoro-4-[methoxy(dimethyl)silyl]-2-(trifluoromethyl)butan-2-yl]oxysilane |
| SMILES | CO[Si](C)(C)CCC(O[Si](C)(C)C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H22F6O2Si2/c1-18-21(5,6)8-7-9(10(12,13)14,11(15,16)17)19-20(2,3)4/h7-8H2,1-6H3 |
| InChIKey | HMJYWJWRSOXDRI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[1,1,1-trifluoro-4-[methoxy(dimethyl)silyl]-2-(trifluoromethyl)butan-2-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[1,1,1-trifluoro-4-[methoxy(dimethyl)silyl]-2-(trifluoromethyl)butan-2-yl]oxysilane?
The IUPAC name of trimethyl-[1,1,1-trifluoro-4-[methoxy(dimethyl)silyl]-2-(trifluoromethyl)butan-2-yl]oxysilane (CID 21365449) is trimethyl-[1,1,1-trifluoro-4-[methoxy(dimethyl)silyl]-2-(trifluoromethyl)butan-2-yl]oxysilane.
What is the SMILES notation for trimethyl-[1,1,1-trifluoro-4-[methoxy(dimethyl)silyl]-2-(trifluoromethyl)butan-2-yl]oxysilane?
The canonical SMILES for trimethyl-[1,1,1-trifluoro-4-[methoxy(dimethyl)silyl]-2-(trifluoromethyl)butan-2-yl]oxysilane is CO[Si](C)(C)CCC(O[Si](C)(C)C)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of trimethyl-[1,1,1-trifluoro-4-[methoxy(dimethyl)silyl]-2-(trifluoromethyl)butan-2-yl]oxysilane?
The InChIKey is HMJYWJWRSOXDRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F6O2Si2/c1-18-21(5,6)8-7-9(10(12,13)14,11(15,16)17)19-20(2,3)4/h7-8H2,1-6H3.
What are the key properties of trimethyl-[1,1,1-trifluoro-4-[methoxy(dimethyl)silyl]-2-(trifluoromethyl)butan-2-yl]oxysilane?
trimethyl-[1,1,1-trifluoro-4-[methoxy(dimethyl)silyl]-2-(trifluoromethyl)butan-2-yl]oxysilane has a molecular weight of 356.46 g/mol, XLogP of 4.94, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[1,1,1-trifluoro-4-[methoxy(dimethyl)silyl]-2-(trifluoromethyl)butan-2-yl]oxysilane is sourced from PubChem (CID 21365449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).