C16H24F12O4Si — CID 21365452
methyl-propyl-bis[4,4,4-trifluoro-3-methoxy-3-(trifluoromethyl)butoxy]silane (PubChem CID 21365452) has the molecular formula C16H24F12O4Si and a molecular weight of 536.43 g/mol. Its IUPAC name is methyl-propyl-bis[4,4,4-trifluoro-3-methoxy-3-(trifluoromethyl)butoxy]silane.
| Compound Name | methyl-propyl-bis[4,4,4-trifluoro-3-methoxy-3-(trifluoromethyl)butoxy]silane |
|---|---|
| PubChem CID | 21365452 |
| Molecular Formula | C16H24F12O4Si |
| Molecular Weight | 536.43 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | methyl-propyl-bis[4,4,4-trifluoro-3-methoxy-3-(trifluoromethyl)butoxy]silane |
| SMILES | CCC[Si](C)(OCCC(OC)(C(F)(F)F)C(F)(F)F)OCCC(OC)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H24F12O4Si/c1-5-10-33(4,31-8-6-11(29-2,13(17,18)19)14(20,21)22)32-9-7-12(30-3,15(23,24)25)16(26,27)28/h5-10H2,1-4H3 |
| InChIKey | LZXWONMAZBZNAY-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.43 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|