About 5-methyl-3-methylsulfanyl-1,2,4-thiadiazole
5-methyl-3-methylsulfanyl-1,2,4-thiadiazole (PubChem CID 21365791) has the molecular formula C4H6N2S2
and a molecular weight of 146.24 g/mol. Its IUPAC name is 5-methyl-3-methylsulfanyl-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 5-methyl-3-methylsulfanyl-1,2,4-thiadiazole |
| PubChem CID | 21365791 |
| Molecular Formula | C4H6N2S2 |
| Molecular Weight | 146.24 g/mol |
| Exact Mass | 146.00 |
| IUPAC Name | 5-methyl-3-methylsulfanyl-1,2,4-thiadiazole |
| SMILES | CSc1nsc(C)n1 |
| InChI | InChI=1S/C4H6N2S2/c1-3-5-4(7-2)6-8-3/h1-2H3 |
| InChIKey | YLKHKYXHQOAANY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-3-methylsulfanyl-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-methylsulfanyl-1,2,4-thiadiazole?
The IUPAC name of 5-methyl-3-methylsulfanyl-1,2,4-thiadiazole (CID 21365791) is 5-methyl-3-methylsulfanyl-1,2,4-thiadiazole.
What is the SMILES notation for 5-methyl-3-methylsulfanyl-1,2,4-thiadiazole?
The canonical SMILES for 5-methyl-3-methylsulfanyl-1,2,4-thiadiazole is CSc1nsc(C)n1.
What is the InChIKey of 5-methyl-3-methylsulfanyl-1,2,4-thiadiazole?
The InChIKey is YLKHKYXHQOAANY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2S2/c1-3-5-4(7-2)6-8-3/h1-2H3.
What are the key properties of 5-methyl-3-methylsulfanyl-1,2,4-thiadiazole?
5-methyl-3-methylsulfanyl-1,2,4-thiadiazole has a molecular weight of 146.24 g/mol, XLogP of 1.57, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-methylsulfanyl-1,2,4-thiadiazole is sourced from PubChem (CID 21365791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).