C6H15O15P3 — CID 21365861
[(2S,3S,4R,5R)-5-hydroxy-2-(hydroxymethyl)-2,3-diphosphonooxyoxan-4-yl] dihydrogen phosphate (PubChem CID 21365861) has the molecular formula C6H15O15P3 and a molecular weight of 420.09 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-hydroxy-2-(hydroxymethyl)-2,3-diphosphonooxyoxan-4-yl] dihydrogen phosphate.
| Compound Name | [(2S,3S,4R,5R)-5-hydroxy-2-(hydroxymethyl)-2,3-diphosphonooxyoxan-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 21365861 |
| Molecular Formula | C6H15O15P3 |
| Molecular Weight | 420.09 g/mol |
| Exact Mass | 419.96 |
| IUPAC Name | [(2S,3S,4R,5R)-5-hydroxy-2-(hydroxymethyl)-2,3-diphosphonooxyoxan-4-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)O[C@@H]1[C@H](O)CO[C@@](CO)(OP(=O)(O)O)[C@H]1OP(=O)(O)O |
| InChI | InChI=1S/C6H15O15P3/c7-2-6(21-24(15,16)17)5(20-23(12,13)14)4(3(8)1-18-6)19-22(9,10)11/h3-5,7-8H,1-2H2,(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)/t3-,4-,5+,6+/m1/s1 |
| InChIKey | GDIXLSHFOCOHNM-ZXXMMSQZSA-N |
| XLogP | -2.87 |
| TPSA | 249.97 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.09 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|