C9H21O15P3 — CID 21365875
[(1S,2S,4R,5S)-2,3,4-trimethoxy-5,6-diphosphonooxycyclohexyl] dihydrogen phosphate (PubChem CID 21365875) has the molecular formula C9H21O15P3 and a molecular weight of 462.17 g/mol. Its IUPAC name is [(1S,2S,4R,5S)-2,3,4-trimethoxy-5,6-diphosphonooxycyclohexyl] dihydrogen phosphate.
| Compound Name | [(1S,2S,4R,5S)-2,3,4-trimethoxy-5,6-diphosphonooxycyclohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 21365875 |
| Molecular Formula | C9H21O15P3 |
| Molecular Weight | 462.17 g/mol |
| Exact Mass | 462.01 |
| IUPAC Name | [(1S,2S,4R,5S)-2,3,4-trimethoxy-5,6-diphosphonooxycyclohexyl] dihydrogen phosphate |
| SMILES | COC1[C@@H](OC)[C@H](OP(=O)(O)O)C(OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H]1OC |
| InChI | InChI=1S/C9H21O15P3/c1-19-4-5(20-2)7(22-25(10,11)12)9(24-27(16,17)18)8(6(4)21-3)23-26(13,14)15/h4-9H,1-3H3,(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)/t4?,5-,6+,7-,8-,9?/m0/s1 |
| InChIKey | HPACEPMFCMPMJG-VCQVLUMJSA-N |
| XLogP | -1.52 |
| TPSA | 227.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.17 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|