About ethyl N-[6-(2,4,5-trifluorophenyl)-1H-benzimidazol-2-yl]carbamate
ethyl N-[6-(2,4,5-trifluorophenyl)-1H-benzimidazol-2-yl]carbamate (PubChem CID 21366079) has the molecular formula C16H12F3N3O2
and a molecular weight of 335.29 g/mol. Its IUPAC name is ethyl N-[6-(2,4,5-trifluorophenyl)-1H-benzimidazol-2-yl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[6-(2,4,5-trifluorophenyl)-1H-benzimidazol-2-yl]carbamate |
| PubChem CID | 21366079 |
| Molecular Formula | C16H12F3N3O2 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | ethyl N-[6-(2,4,5-trifluorophenyl)-1H-benzimidazol-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1nc2ccc(-c3cc(F)c(F)cc3F)cc2[nH]1 |
| InChI | InChI=1S/C16H12F3N3O2/c1-2-24-16(23)22-15-20-13-4-3-8(5-14(13)21-15)9-6-11(18)12(19)7-10(9)17/h3-7H,2H2,1H3,(H2,20,21,22,23) |
| InChIKey | CPHYUPGUDVJUSY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[6-(2,4,5-trifluorophenyl)-1H-benzimidazol-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[6-(2,4,5-trifluorophenyl)-1H-benzimidazol-2-yl]carbamate?
The IUPAC name of ethyl N-[6-(2,4,5-trifluorophenyl)-1H-benzimidazol-2-yl]carbamate (CID 21366079) is ethyl N-[6-(2,4,5-trifluorophenyl)-1H-benzimidazol-2-yl]carbamate.
What is the SMILES notation for ethyl N-[6-(2,4,5-trifluorophenyl)-1H-benzimidazol-2-yl]carbamate?
The canonical SMILES for ethyl N-[6-(2,4,5-trifluorophenyl)-1H-benzimidazol-2-yl]carbamate is CCOC(=O)Nc1nc2ccc(-c3cc(F)c(F)cc3F)cc2[nH]1.
What is the InChIKey of ethyl N-[6-(2,4,5-trifluorophenyl)-1H-benzimidazol-2-yl]carbamate?
The InChIKey is CPHYUPGUDVJUSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F3N3O2/c1-2-24-16(23)22-15-20-13-4-3-8(5-14(13)21-15)9-6-11(18)12(19)7-10(9)17/h3-7H,2H2,1H3,(H2,20,21,22,23).
What are the key properties of ethyl N-[6-(2,4,5-trifluorophenyl)-1H-benzimidazol-2-yl]carbamate?
ethyl N-[6-(2,4,5-trifluorophenyl)-1H-benzimidazol-2-yl]carbamate has a molecular weight of 335.29 g/mol, XLogP of 4.22, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[6-(2,4,5-trifluorophenyl)-1H-benzimidazol-2-yl]carbamate is sourced from PubChem (CID 21366079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).