C15H22N2OS — CID 21366203
4-methyl-3-(methylamino)-1-thiophen-3-yl-3,4,5,5a,6,7,8,8a-octahydrocyclopenta[b]azepin-2-one (PubChem CID 21366203) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is 4-methyl-3-(methylamino)-1-thiophen-3-yl-3,4,5,5a,6,7,8,8a-octahydrocyclopenta[b]azepin-2-one.
| Compound Name | 4-methyl-3-(methylamino)-1-thiophen-3-yl-3,4,5,5a,6,7,8,8a-octahydrocyclopenta[b]azepin-2-one |
|---|---|
| PubChem CID | 21366203 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 4-methyl-3-(methylamino)-1-thiophen-3-yl-3,4,5,5a,6,7,8,8a-octahydrocyclopenta[b]azepin-2-one |
| SMILES | CNC1C(=O)N(c2ccsc2)C2CCCC2CC1C |
| InChI | InChI=1S/C15H22N2OS/c1-10-8-11-4-3-5-13(11)17(12-6-7-19-9-12)15(18)14(10)16-2/h6-7,9-11,13-14,16H,3-5,8H2,1-2H3 |
| InChIKey | DDIUFYLXQKJEEI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |