C27H33F3N4O2 — CID 21366243
(2S)-2-[(dimethylamino)methyl]-N-[1-methyl-2-oxo-5-[2-(trifluoromethyl)phenyl]-3H-1,4-benzodiazepin-3-yl]heptanamide (PubChem CID 21366243) has the molecular formula C27H33F3N4O2 and a molecular weight of 502.58 g/mol. Its IUPAC name is (2S)-2-[(dimethylamino)methyl]-N-[1-methyl-2-oxo-5-[2-(trifluoromethyl)phenyl]-3H-1,4-benzodiazepin-3-yl]heptanamide.
| Compound Name | (2S)-2-[(dimethylamino)methyl]-N-[1-methyl-2-oxo-5-[2-(trifluoromethyl)phenyl]-3H-1,4-benzodiazepin-3-yl]heptanamide |
|---|---|
| PubChem CID | 21366243 |
| Molecular Formula | C27H33F3N4O2 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | (2S)-2-[(dimethylamino)methyl]-N-[1-methyl-2-oxo-5-[2-(trifluoromethyl)phenyl]-3H-1,4-benzodiazepin-3-yl]heptanamide |
| SMILES | CCCCC[C@@H](CN(C)C)C(=O)NC1N=C(c2ccccc2C(F)(F)F)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C27H33F3N4O2/c1-5-6-7-12-18(17-33(2)3)25(35)32-24-26(36)34(4)22-16-11-9-14-20(22)23(31-24)19-13-8-10-15-21(19)27(28,29)30/h8-11,13-16,18,24H,5-7,12,17H2,1-4H3,(H,32,35)/t18-,24?/m0/s1 |
| InChIKey | QKBDRIPFJDPZFF-VEXWJQHLSA-N |
| XLogP | 4.72 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|