About 2-[2-(2-methylphenyl)ethyl]-4,5-dihydro-1H-imidazole
2-[2-(2-methylphenyl)ethyl]-4,5-dihydro-1H-imidazole (PubChem CID 21366506) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-[2-(2-methylphenyl)ethyl]-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-[2-(2-methylphenyl)ethyl]-4,5-dihydro-1H-imidazole |
| PubChem CID | 21366506 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-[2-(2-methylphenyl)ethyl]-4,5-dihydro-1H-imidazole |
| SMILES | Cc1ccccc1CCC1=NCCN1 |
| InChI | InChI=1S/C12H16N2/c1-10-4-2-3-5-11(10)6-7-12-13-8-9-14-12/h2-5H,6-9H2,1H3,(H,13,14) |
| InChIKey | MSVQQCPWZLKQQB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2-(2-methylphenyl)ethyl]-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-methylphenyl)ethyl]-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-[2-(2-methylphenyl)ethyl]-4,5-dihydro-1H-imidazole (CID 21366506) is 2-[2-(2-methylphenyl)ethyl]-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-[2-(2-methylphenyl)ethyl]-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-[2-(2-methylphenyl)ethyl]-4,5-dihydro-1H-imidazole is Cc1ccccc1CCC1=NCCN1.
What is the InChIKey of 2-[2-(2-methylphenyl)ethyl]-4,5-dihydro-1H-imidazole?
The InChIKey is MSVQQCPWZLKQQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-10-4-2-3-5-11(10)6-7-12-13-8-9-14-12/h2-5H,6-9H2,1H3,(H,13,14).
What are the key properties of 2-[2-(2-methylphenyl)ethyl]-4,5-dihydro-1H-imidazole?
2-[2-(2-methylphenyl)ethyl]-4,5-dihydro-1H-imidazole has a molecular weight of 188.27 g/mol, XLogP of 1.93, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-methylphenyl)ethyl]-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 21366506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).