C19H22Cl2N2O3S — CID 21366899
4-(2,5-dichloro-N-methylsulfonylanilino)-N-(2-ethylphenyl)butanamide (PubChem CID 21366899) has the molecular formula C19H22Cl2N2O3S and a molecular weight of 429.37 g/mol. Its IUPAC name is 4-(2,5-dichloro-N-methylsulfonylanilino)-N-(2-ethylphenyl)butanamide.
| Compound Name | 4-(2,5-dichloro-N-methylsulfonylanilino)-N-(2-ethylphenyl)butanamide |
|---|---|
| PubChem CID | 21366899 |
| Molecular Formula | C19H22Cl2N2O3S |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 4-(2,5-dichloro-N-methylsulfonylanilino)-N-(2-ethylphenyl)butanamide |
| SMILES | CCc1ccccc1NC(=O)CCCN(c1cc(Cl)ccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C19H22Cl2N2O3S/c1-3-14-7-4-5-8-17(14)22-19(24)9-6-12-23(27(2,25)26)18-13-15(20)10-11-16(18)21/h4-5,7-8,10-11,13H,3,6,9,12H2,1-2H3,(H,22,24) |
| InChIKey | QOEVJBINNZDXLP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |