C28H32FN3O3S — CID 21368140
N-[4-(4-benzhydrylpiperazin-1-yl)-4-oxobutyl]-N-(4-fluorophenyl)methanesulfonamide (PubChem CID 21368140) has the molecular formula C28H32FN3O3S and a molecular weight of 509.65 g/mol. Its IUPAC name is N-[4-(4-benzhydrylpiperazin-1-yl)-4-oxobutyl]-N-(4-fluorophenyl)methanesulfonamide.
| Compound Name | N-[4-(4-benzhydrylpiperazin-1-yl)-4-oxobutyl]-N-(4-fluorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 21368140 |
| Molecular Formula | C28H32FN3O3S |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | N-[4-(4-benzhydrylpiperazin-1-yl)-4-oxobutyl]-N-(4-fluorophenyl)methanesulfonamide |
| SMILES | CS(=O)(=O)N(CCCC(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H32FN3O3S/c1-36(34,35)32(26-16-14-25(29)15-17-26)18-8-13-27(33)30-19-21-31(22-20-30)28(23-9-4-2-5-10-23)24-11-6-3-7-12-24/h2-7,9-12,14-17,28H,8,13,18-22H2,1H3 |
| InChIKey | IXAWADLERHPTIM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |