C18H14N6O4 — CID 21369524
3-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]-N-(1,2,4-triazol-4-yl)benzamide (PubChem CID 21369524) has the molecular formula C18H14N6O4 and a molecular weight of 378.35 g/mol. Its IUPAC name is 3-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]-N-(1,2,4-triazol-4-yl)benzamide.
| Compound Name | 3-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]-N-(1,2,4-triazol-4-yl)benzamide |
|---|---|
| PubChem CID | 21369524 |
| Molecular Formula | C18H14N6O4 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 3-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]-N-(1,2,4-triazol-4-yl)benzamide |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)Nc1cccc(C(=O)Nn2cnnc2)c1 |
| InChI | InChI=1S/C18H14N6O4/c25-17(8-7-13-3-1-6-16(9-13)24(27)28)21-15-5-2-4-14(10-15)18(26)22-23-11-19-20-12-23/h1-12H,(H,21,25)(H,22,26)/b8-7+ |
| InChIKey | SGERXGXHGBNTSK-BQYQJAHWSA-N |
| XLogP | 2.22 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|