About N-(3-methylbutyl)-N'-prop-2-enyloxamide
N-(3-methylbutyl)-N'-prop-2-enyloxamide (PubChem CID 21369924) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is N-(3-methylbutyl)-N'-prop-2-enyloxamide.
Molecular Properties
| Compound Name | N-(3-methylbutyl)-N'-prop-2-enyloxamide |
| PubChem CID | 21369924 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | N-(3-methylbutyl)-N'-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)NCCC(C)C |
| InChI | InChI=1S/C10H18N2O2/c1-4-6-11-9(13)10(14)12-7-5-8(2)3/h4,8H,1,5-7H2,2-3H3,(H,11,13)(H,12,14) |
| InChIKey | YOSNUQBXEBDQTR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methylbutyl)-N'-prop-2-enyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methylbutyl)-N'-prop-2-enyloxamide?
The IUPAC name of N-(3-methylbutyl)-N'-prop-2-enyloxamide (CID 21369924) is N-(3-methylbutyl)-N'-prop-2-enyloxamide.
What is the SMILES notation for N-(3-methylbutyl)-N'-prop-2-enyloxamide?
The canonical SMILES for N-(3-methylbutyl)-N'-prop-2-enyloxamide is C=CCNC(=O)C(=O)NCCC(C)C.
What is the InChIKey of N-(3-methylbutyl)-N'-prop-2-enyloxamide?
The InChIKey is YOSNUQBXEBDQTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2/c1-4-6-11-9(13)10(14)12-7-5-8(2)3/h4,8H,1,5-7H2,2-3H3,(H,11,13)(H,12,14).
What are the key properties of N-(3-methylbutyl)-N'-prop-2-enyloxamide?
N-(3-methylbutyl)-N'-prop-2-enyloxamide has a molecular weight of 198.27 g/mol, XLogP of 0.45, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methylbutyl)-N'-prop-2-enyloxamide is sourced from PubChem (CID 21369924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).