C32H26N2O8 — CID 21370456
[4-[10-[bis(4-methoxyphenyl)methylidene]-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-nitrophenyl] acetate (PubChem CID 21370456) has the molecular formula C32H26N2O8 and a molecular weight of 566.57 g/mol. Its IUPAC name is [4-[10-[bis(4-methoxyphenyl)methylidene]-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-nitrophenyl] acetate.
| Compound Name | [4-[10-[bis(4-methoxyphenyl)methylidene]-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-nitrophenyl] acetate |
|---|---|
| PubChem CID | 21370456 |
| Molecular Formula | C32H26N2O8 |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | [4-[10-[bis(4-methoxyphenyl)methylidene]-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-nitrophenyl] acetate |
| SMILES | COc1ccc(C(=C2C3C=CC2C2C(=O)N(c4ccc(OC(C)=O)c([N+](=O)[O-])c4)C(=O)C32)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H26N2O8/c1-17(35)42-26-15-8-20(16-25(26)34(38)39)33-31(36)29-23-13-14-24(30(29)32(33)37)28(23)27(18-4-9-21(40-2)10-5-18)19-6-11-22(41-3)12-7-19/h4-16,23-24,29-30H,1-3H3 |
| InChIKey | FNXPZMMKIMUCEB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|