C25H21NO4 — CID 2137046
1-benzyl-3-(3,4-dimethoxybenzoyl)quinolin-4-one (PubChem CID 2137046) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 1-benzyl-3-(3,4-dimethoxybenzoyl)quinolin-4-one.
| Compound Name | 1-benzyl-3-(3,4-dimethoxybenzoyl)quinolin-4-one |
|---|---|
| PubChem CID | 2137046 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 1-benzyl-3-(3,4-dimethoxybenzoyl)quinolin-4-one |
| SMILES | COc1ccc(C(=O)c2cn(Cc3ccccc3)c3ccccc3c2=O)cc1OC |
| InChI | InChI=1S/C25H21NO4/c1-29-22-13-12-18(14-23(22)30-2)24(27)20-16-26(15-17-8-4-3-5-9-17)21-11-7-6-10-19(21)25(20)28/h3-14,16H,15H2,1-2H3 |
| InChIKey | LQAMHZXLAZCLRS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |