C24H22N6OS — CID 21371554
2-[(4,6-dianilino-1,3,5-triazin-2-yl)sulfanyl]-N-(3-methylphenyl)acetamide (PubChem CID 21371554) has the molecular formula C24H22N6OS and a molecular weight of 442.55 g/mol. Its IUPAC name is 2-[(4,6-dianilino-1,3,5-triazin-2-yl)sulfanyl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[(4,6-dianilino-1,3,5-triazin-2-yl)sulfanyl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 21371554 |
| Molecular Formula | C24H22N6OS |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2-[(4,6-dianilino-1,3,5-triazin-2-yl)sulfanyl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CSc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)c1 |
| InChI | InChI=1S/C24H22N6OS/c1-17-9-8-14-20(15-17)25-21(31)16-32-24-29-22(26-18-10-4-2-5-11-18)28-23(30-24)27-19-12-6-3-7-13-19/h2-15H,16H2,1H3,(H,25,31)(H2,26,27,28,29,30) |
| InChIKey | YUUJXZACLANZLU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |