C24H26ClN3O5S2 — CID 21371880
2-[N-(benzenesulfonyl)-2-chloroanilino]-N-[4-(diethylsulfamoyl)phenyl]acetamide (PubChem CID 21371880) has the molecular formula C24H26ClN3O5S2 and a molecular weight of 536.08 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-chloroanilino]-N-[4-(diethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-chloroanilino]-N-[4-(diethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 21371880 |
| Molecular Formula | C24H26ClN3O5S2 |
| Molecular Weight | 536.08 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-chloroanilino]-N-[4-(diethylsulfamoyl)phenyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)CN(c2ccccc2Cl)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H26ClN3O5S2/c1-3-27(4-2)34(30,31)21-16-14-19(15-17-21)26-24(29)18-28(23-13-9-8-12-22(23)25)35(32,33)20-10-6-5-7-11-20/h5-17H,3-4,18H2,1-2H3,(H,26,29) |
| InChIKey | CREZVGKYCKGMDF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.08 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |