C18H25N3O2S — CID 21373732
4-cyclohexyl-3-[2-(2-methoxyphenoxy)ethylsulfanyl]-5-methyl-1,2,4-triazole (PubChem CID 21373732) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is 4-cyclohexyl-3-[2-(2-methoxyphenoxy)ethylsulfanyl]-5-methyl-1,2,4-triazole.
| Compound Name | 4-cyclohexyl-3-[2-(2-methoxyphenoxy)ethylsulfanyl]-5-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 21373732 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 4-cyclohexyl-3-[2-(2-methoxyphenoxy)ethylsulfanyl]-5-methyl-1,2,4-triazole |
| SMILES | COc1ccccc1OCCSc1nnc(C)n1C1CCCCC1 |
| InChI | InChI=1S/C18H25N3O2S/c1-14-19-20-18(21(14)15-8-4-3-5-9-15)24-13-12-23-17-11-7-6-10-16(17)22-2/h6-7,10-11,15H,3-5,8-9,12-13H2,1-2H3 |
| InChIKey | VLRVKVOUNWZPJC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|