C24H14BrF3N2O2 — CID 21374014
2-[[2-bromo-4-[(E)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 21374014) has the molecular formula C24H14BrF3N2O2 and a molecular weight of 499.29 g/mol. Its IUPAC name is 2-[[2-bromo-4-[(E)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-bromo-4-[(E)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 21374014 |
| Molecular Formula | C24H14BrF3N2O2 |
| Molecular Weight | 499.29 g/mol |
| Exact Mass | 498.02 |
| IUPAC Name | 2-[[2-bromo-4-[(E)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1ccc(/C=C2/C(=O)Nc3cc(C(F)(F)F)ccc32)cc1Br |
| InChI | InChI=1S/C24H14BrF3N2O2/c25-20-10-14(5-8-22(20)32-13-16-4-2-1-3-15(16)12-29)9-19-18-7-6-17(24(26,27)28)11-21(18)30-23(19)31/h1-11H,13H2,(H,30,31)/b19-9+ |
| InChIKey | QZOCEEGXRWKJIW-DJKKODMXSA-N |
| XLogP | 6.41 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.29 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|