C30H27F3N2O2 — CID 21374174
(3E)-3-[[1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]indol-3-yl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 21374174) has the molecular formula C30H27F3N2O2 and a molecular weight of 504.55 g/mol. Its IUPAC name is (3E)-3-[[1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]indol-3-yl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3E)-3-[[1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]indol-3-yl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 21374174 |
| Molecular Formula | C30H27F3N2O2 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | (3E)-3-[[1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]indol-3-yl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | Cc1ccc(C(C)C)c(OCCn2cc(/C=C3/C(=O)Nc4cc(C(F)(F)F)ccc43)c3ccccc32)c1 |
| InChI | InChI=1S/C30H27F3N2O2/c1-18(2)22-10-8-19(3)14-28(22)37-13-12-35-17-20(23-6-4-5-7-27(23)35)15-25-24-11-9-21(30(31,32)33)16-26(24)34-29(25)36/h4-11,14-18H,12-13H2,1-3H3,(H,34,36)/b25-15+ |
| InChIKey | PNTVVRNWGXVQOZ-MFKUBSTISA-N |
| XLogP | 7.66 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|