About 5-chloro-3-(3-fluorophenyl)triazolo[1,5-a]quinazoline
5-chloro-3-(3-fluorophenyl)triazolo[1,5-a]quinazoline (PubChem CID 2137463) has the molecular formula C15H8ClFN4
and a molecular weight of 298.71 g/mol. Its IUPAC name is 5-chloro-3-(3-fluorophenyl)triazolo[1,5-a]quinazoline.
Molecular Properties
| Compound Name | 5-chloro-3-(3-fluorophenyl)triazolo[1,5-a]quinazoline |
| PubChem CID | 2137463 |
| Molecular Formula | C15H8ClFN4 |
| Molecular Weight | 298.71 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 5-chloro-3-(3-fluorophenyl)triazolo[1,5-a]quinazoline |
| SMILES | Fc1cccc(-c2nnn3c2nc(Cl)c2ccccc23)c1 |
| InChI | InChI=1S/C15H8ClFN4/c16-14-11-6-1-2-7-12(11)21-15(18-14)13(19-20-21)9-4-3-5-10(17)8-9/h1-8H |
| InChIKey | SFXLYSMIOXLDLY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.71 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-3-(3-fluorophenyl)triazolo[1,5-a]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-(3-fluorophenyl)triazolo[1,5-a]quinazoline?
The IUPAC name of 5-chloro-3-(3-fluorophenyl)triazolo[1,5-a]quinazoline (CID 2137463) is 5-chloro-3-(3-fluorophenyl)triazolo[1,5-a]quinazoline.
What is the SMILES notation for 5-chloro-3-(3-fluorophenyl)triazolo[1,5-a]quinazoline?
The canonical SMILES for 5-chloro-3-(3-fluorophenyl)triazolo[1,5-a]quinazoline is Fc1cccc(-c2nnn3c2nc(Cl)c2ccccc23)c1.
What is the InChIKey of 5-chloro-3-(3-fluorophenyl)triazolo[1,5-a]quinazoline?
The InChIKey is SFXLYSMIOXLDLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8ClFN4/c16-14-11-6-1-2-7-12(11)21-15(18-14)13(19-20-21)9-4-3-5-10(17)8-9/h1-8H.
What are the key properties of 5-chloro-3-(3-fluorophenyl)triazolo[1,5-a]quinazoline?
5-chloro-3-(3-fluorophenyl)triazolo[1,5-a]quinazoline has a molecular weight of 298.71 g/mol, XLogP of 3.74, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-(3-fluorophenyl)triazolo[1,5-a]quinazoline is sourced from PubChem (CID 2137463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).