C22H20N2 — CID 21375475
(E)-3-[1-(3,4-dimethylphenyl)pyrrol-2-yl]-2-(4-methylphenyl)prop-2-enenitrile (PubChem CID 21375475) has the molecular formula C22H20N2 and a molecular weight of 312.42 g/mol. Its IUPAC name is (E)-3-[1-(3,4-dimethylphenyl)pyrrol-2-yl]-2-(4-methylphenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[1-(3,4-dimethylphenyl)pyrrol-2-yl]-2-(4-methylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 21375475 |
| Molecular Formula | C22H20N2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (E)-3-[1-(3,4-dimethylphenyl)pyrrol-2-yl]-2-(4-methylphenyl)prop-2-enenitrile |
| SMILES | Cc1ccc(/C(C#N)=C\c2cccn2-c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C22H20N2/c1-16-6-9-19(10-7-16)20(15-23)14-21-5-4-12-24(21)22-11-8-17(2)18(3)13-22/h4-14H,1-3H3/b20-14- |
| InChIKey | RWDGWEMANKKCDK-ZHZULCJRSA-N |
| XLogP | 5.47 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|