C23H30NO5+ — CID 2137617
(2R)-1-(4-benzylmorpholin-4-ium-4-yl)-3-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methoxy]propan-2-ol (PubChem CID 2137617) has the molecular formula C23H30NO5+ and a molecular weight of 400.50 g/mol. Its IUPAC name is (2R)-1-(4-benzylmorpholin-4-ium-4-yl)-3-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methoxy]propan-2-ol.
| Compound Name | (2R)-1-(4-benzylmorpholin-4-ium-4-yl)-3-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methoxy]propan-2-ol |
|---|---|
| PubChem CID | 2137617 |
| Molecular Formula | C23H30NO5+ |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | (2R)-1-(4-benzylmorpholin-4-ium-4-yl)-3-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methoxy]propan-2-ol |
| SMILES | O[C@@H](COC[C@H]1COc2ccccc2O1)C[N+]1(Cc2ccccc2)CCOCC1 |
| InChI | InChI=1S/C23H30NO5/c25-20(16-27-17-21-18-28-22-8-4-5-9-23(22)29-21)15-24(10-12-26-13-11-24)14-19-6-2-1-3-7-19/h1-9,20-21,25H,10-18H2/q+1/t20-,21+/m1/s1 |
| InChIKey | ABLIITXQHKILBI-RTWAWAEBSA-N |
| XLogP | 2.25 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|