C23H18N2O6S — CID 21376465
(5E)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 21376465) has the molecular formula C23H18N2O6S and a molecular weight of 450.47 g/mol. Its IUPAC name is (5E)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 21376465 |
| Molecular Formula | C23H18N2O6S |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | (5E)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2/SC(=O)N(Cc3cccc4ccccc34)C2=O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C23H18N2O6S/c1-30-19-10-16(18(25(28)29)12-20(19)31-2)11-21-22(26)24(23(27)32-21)13-15-8-5-7-14-6-3-4-9-17(14)15/h3-12H,13H2,1-2H3/b21-11+ |
| InChIKey | OQQBEHZMVNVKNA-SRZZPIQSSA-N |
| XLogP | 5.00 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|