C29H22INO3S — CID 21376773
(5E)-5-[[3-iodo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 21376773) has the molecular formula C29H22INO3S and a molecular weight of 591.47 g/mol. Its IUPAC name is (5E)-5-[[3-iodo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-iodo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 21376773 |
| Molecular Formula | C29H22INO3S |
| Molecular Weight | 591.47 g/mol |
| Exact Mass | 591.04 |
| IUPAC Name | (5E)-5-[[3-iodo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cccc(COc2ccc(/C=C3/SC(=O)N(Cc4cccc5ccccc45)C3=O)cc2I)c1 |
| InChI | InChI=1S/C29H22INO3S/c1-19-6-4-7-21(14-19)18-34-26-13-12-20(15-25(26)30)16-27-28(32)31(29(33)35-27)17-23-10-5-9-22-8-2-3-11-24(22)23/h2-16H,17-18H2,1H3/b27-16+ |
| InChIKey | XDDBFAFFYLONKT-JVWAILMASA-N |
| XLogP | 7.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.47 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|