C19H19NO2S — CID 2137736
(3-hydroxy-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-(2,4,6-trimethylphenyl)methanone (PubChem CID 2137736) has the molecular formula C19H19NO2S and a molecular weight of 325.43 g/mol. Its IUPAC name is (3-hydroxy-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-(2,4,6-trimethylphenyl)methanone.
| Compound Name | (3-hydroxy-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 2137736 |
| Molecular Formula | C19H19NO2S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | (3-hydroxy-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)c2sc3nc(C)cc(C)c3c2O)c(C)c1 |
| InChI | InChI=1S/C19H19NO2S/c1-9-6-10(2)14(11(3)7-9)16(21)18-17(22)15-12(4)8-13(5)20-19(15)23-18/h6-8,22H,1-5H3 |
| InChIKey | HWXVAPYBFNXYMM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|