About 4-benzyl-1lambda6,2,4-benzothiadiazine 1,1-dioxide
4-benzyl-1lambda6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 2137928) has the molecular formula C14H12N2O2S
and a molecular weight of 272.33 g/mol. Its IUPAC name is 4-benzyl-1lambda6,2,4-benzothiadiazine 1,1-dioxide.
Molecular Properties
| Compound Name | 4-benzyl-1lambda6,2,4-benzothiadiazine 1,1-dioxide |
| PubChem CID | 2137928 |
| Molecular Formula | C14H12N2O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 4-benzyl-1lambda6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | O=S1(=O)N=CN(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C14H12N2O2S/c17-19(18)14-9-5-4-8-13(14)16(11-15-19)10-12-6-2-1-3-7-12/h1-9,11H,10H2 |
| InChIKey | RLNUFLISUNERNZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-benzyl-1lambda6,2,4-benzothiadiazine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-1lambda6,2,4-benzothiadiazine 1,1-dioxide?
The IUPAC name of 4-benzyl-1lambda6,2,4-benzothiadiazine 1,1-dioxide (CID 2137928) is 4-benzyl-1lambda6,2,4-benzothiadiazine 1,1-dioxide.
What is the SMILES notation for 4-benzyl-1lambda6,2,4-benzothiadiazine 1,1-dioxide?
The canonical SMILES for 4-benzyl-1lambda6,2,4-benzothiadiazine 1,1-dioxide is O=S1(=O)N=CN(Cc2ccccc2)c2ccccc21.
What is the InChIKey of 4-benzyl-1lambda6,2,4-benzothiadiazine 1,1-dioxide?
The InChIKey is RLNUFLISUNERNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O2S/c17-19(18)14-9-5-4-8-13(14)16(11-15-19)10-12-6-2-1-3-7-12/h1-9,11H,10H2.
What are the key properties of 4-benzyl-1lambda6,2,4-benzothiadiazine 1,1-dioxide?
4-benzyl-1lambda6,2,4-benzothiadiazine 1,1-dioxide has a molecular weight of 272.33 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-1lambda6,2,4-benzothiadiazine 1,1-dioxide is sourced from PubChem (CID 2137928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).