C11H18N3OS+ — CID 2137935
6-butyl-2-sulfanylidene-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidin-6-ium-4-one (PubChem CID 2137935) has the molecular formula C11H18N3OS+ and a molecular weight of 240.35 g/mol. Its IUPAC name is 6-butyl-2-sulfanylidene-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidin-6-ium-4-one.
| Compound Name | 6-butyl-2-sulfanylidene-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidin-6-ium-4-one |
|---|---|
| PubChem CID | 2137935 |
| Molecular Formula | C11H18N3OS+ |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 6-butyl-2-sulfanylidene-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidin-6-ium-4-one |
| SMILES | CCCC[NH+]1CCc2[nH]c(=S)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C11H17N3OS/c1-2-3-5-14-6-4-9-8(7-14)10(15)13-11(16)12-9/h2-7H2,1H3,(H2,12,13,15,16)/p+1 |
| InChIKey | PFVFVDWQRIMZSF-UHFFFAOYSA-O |
| XLogP | 0.17 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|